C20H34O6 — CID 12047129
(3R,4S,5R,6S,7S,11R,12S,13S,14R)-4,6,12-trihydroxy-3,5,7,11,13,14-hexamethyl-9-methylidene-oxacyclotetradecane-2,10-dione (PubChem CID 12047129) has the molecular formula C20H34O6 and a molecular weight of 370.49 g/mol. Its IUPAC name is (3R,4S,5R,6S,7S,11R,12S,13S,14R)-4,6,12-trihydroxy-3,5,7,11,13,14-hexamethyl-9-methylidene-oxacyclotetradecane-2,10-dione.
| Compound Name | (3R,4S,5R,6S,7S,11R,12S,13S,14R)-4,6,12-trihydroxy-3,5,7,11,13,14-hexamethyl-9-methylidene-oxacyclotetradecane-2,10-dione |
|---|---|
| PubChem CID | 12047129 |
| Molecular Formula | C20H34O6 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | (3R,4S,5R,6S,7S,11R,12S,13S,14R)-4,6,12-trihydroxy-3,5,7,11,13,14-hexamethyl-9-methylidene-oxacyclotetradecane-2,10-dione |
| SMILES | C=C1C[C@H](C)[C@H](O)[C@@H](C)[C@H](O)[C@@H](C)C(=O)O[C@H](C)[C@@H](C)[C@H](O)[C@@H](C)C1=O |
| InChI | InChI=1S/C20H34O6/c1-9-8-10(2)17(22)13(5)19(24)14(6)20(25)26-15(7)11(3)18(23)12(4)16(9)21/h10-15,17-19,22-24H,1,8H2,2-7H3/t10-,11+,12-,13+,14+,15+,17-,18-,19-/m0/s1 |
| InChIKey | RZKANKJPSMVYIU-YIHRVPCTSA-N |
| XLogP | 1.71 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|