C16H22BrF3O4 — CID 12047281
(1S,4S,5R,8S,9R,10S,12S,13R)-10-bromo-1,5,9-trimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 12047281) has the molecular formula C16H22BrF3O4 and a molecular weight of 415.25 g/mol. Its IUPAC name is (1S,4S,5R,8S,9R,10S,12S,13R)-10-bromo-1,5,9-trimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (1S,4S,5R,8S,9R,10S,12S,13R)-10-bromo-1,5,9-trimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 12047281 |
| Molecular Formula | C16H22BrF3O4 |
| Molecular Weight | 415.25 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | (1S,4S,5R,8S,9R,10S,12S,13R)-10-bromo-1,5,9-trimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | C[C@@H]1CC[C@H]2[C@@H](C)[C@](Br)(C(F)(F)F)O[C@@H]3O[C@]4(C)CC[C@@H]1[C@]32OO4 |
| InChI | InChI=1S/C16H22BrF3O4/c1-8-4-5-11-9(2)15(17,16(18,19)20)22-12-14(11)10(8)6-7-13(3,21-12)23-24-14/h8-12H,4-7H2,1-3H3/t8-,9-,10+,11+,12+,13+,14-,15-/m1/s1 |
| InChIKey | KCBATTAHFCLYTC-YFNMPKMDSA-N |
| XLogP | 4.52 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.25 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|