C25H44O3Si2 — CID 12047288
cis-(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3-[2-(1-triethylsilyloxycyclopentyl)ethynyl]cyclopentan-1-one (PubChem CID 12047288) has the molecular formula C25H44O3Si2 and a molecular weight of 448.80 g/mol. Its IUPAC name is cis-(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3-[2-(1-triethylsilyloxycyclopentyl)ethynyl]cyclopentan-1-one.
| Compound Name | cis-(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3-[2-(1-triethylsilyloxycyclopentyl)ethynyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 12047288 |
| Molecular Formula | C25H44O3Si2 |
| Molecular Weight | 448.80 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | cis-(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3-[2-(1-triethylsilyloxycyclopentyl)ethynyl]cyclopentan-1-one |
| SMILES | C=C1C(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C#CC1(O[Si](CC)(CC)CC)CCCC1 |
| InChI | InChI=1S/C25H44O3Si2/c1-10-30(11-2,12-3)28-25(16-13-14-17-25)18-15-21-20(4)22(26)19-23(21)27-29(8,9)24(5,6)7/h21,23H,4,10-14,16-17,19H2,1-3,5-9H3/t21-,23-/m1/s1 |
| InChIKey | UOVPJWXXCPJICO-FYYLOGMGSA-N |
| XLogP | 6.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.80 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|