C12H19NO7 — CID 12047353
tert-butyl (3R,3aR,6aR)-3-[(1S)-1,2-dihydroxyethyl]-5-oxo-3,3a,6,6a-tetrahydrofuro[2,3-d][1,2]oxazole-2-carboxylate (PubChem CID 12047353) has the molecular formula C12H19NO7 and a molecular weight of 289.28 g/mol. Its IUPAC name is tert-butyl (3R,3aR,6aR)-3-[(1S)-1,2-dihydroxyethyl]-5-oxo-3,3a,6,6a-tetrahydrofuro[2,3-d][1,2]oxazole-2-carboxylate.
| Compound Name | tert-butyl (3R,3aR,6aR)-3-[(1S)-1,2-dihydroxyethyl]-5-oxo-3,3a,6,6a-tetrahydrofuro[2,3-d][1,2]oxazole-2-carboxylate |
|---|---|
| PubChem CID | 12047353 |
| Molecular Formula | C12H19NO7 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | tert-butyl (3R,3aR,6aR)-3-[(1S)-1,2-dihydroxyethyl]-5-oxo-3,3a,6,6a-tetrahydrofuro[2,3-d][1,2]oxazole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1O[C@@H]2CC(=O)O[C@@H]2[C@H]1[C@H](O)CO |
| InChI | InChI=1S/C12H19NO7/c1-12(2,3)19-11(17)13-9(6(15)5-14)10-7(20-13)4-8(16)18-10/h6-7,9-10,14-15H,4-5H2,1-3H3/t6-,7-,9-,10+/m1/s1 |
| InChIKey | ZJBOXHJMRQUYRL-ZXZZCXTASA-N |
| XLogP | -0.43 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |