C32H46F6O4S — CID 12047667
(7R,8R,9S,13S,14S,16R,17R)-16-fluoro-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfonyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 12047667) has the molecular formula C32H46F6O4S and a molecular weight of 640.77 g/mol. Its IUPAC name is (7R,8R,9S,13S,14S,16R,17R)-16-fluoro-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfonyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (7R,8R,9S,13S,14S,16R,17R)-16-fluoro-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfonyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 12047667 |
| Molecular Formula | C32H46F6O4S |
| Molecular Weight | 640.77 g/mol |
| Exact Mass | 640.30 |
| IUPAC Name | (7R,8R,9S,13S,14S,16R,17R)-16-fluoro-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfonyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4C[C@@H](CCCCCCCCCS(=O)(=O)CCCC(F)(F)C(F)(F)F)[C@H]3[C@@H]1C[C@@H](F)[C@@H]2O |
| InChI | InChI=1S/C32H46F6O4S/c1-30-15-13-25-24-12-11-23(39)19-22(24)18-21(28(25)26(30)20-27(33)29(30)40)10-7-5-3-2-4-6-8-16-43(41,42)17-9-14-31(34,35)32(36,37)38/h11-12,19,21,25-29,39-40H,2-10,13-18,20H2,1H3/t21-,25-,26+,27-,28-,29+,30+/m1/s1 |
| InChIKey | GRCGPZXRAFPTKD-BMCNJFQASA-N |
| XLogP | 8.30 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.77 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|