C21H32O2S2 — CID 12047975
O-[(1S,2S,4S,5S)-4,6,6-trimethyl-4-[2-[(1S)-1-methyl-4-oxocyclohex-2-en-1-yl]ethyl]-2-bicyclo[3.1.1]heptanyl] methylsulfanylmethanethioate (PubChem CID 12047975) has the molecular formula C21H32O2S2 and a molecular weight of 380.62 g/mol. Its IUPAC name is O-[(1S,2S,4S,5S)-4,6,6-trimethyl-4-[2-[(1S)-1-methyl-4-oxocyclohex-2-en-1-yl]ethyl]-2-bicyclo[3.1.1]heptanyl] methylsulfanylmethanethioate.
| Compound Name | O-[(1S,2S,4S,5S)-4,6,6-trimethyl-4-[2-[(1S)-1-methyl-4-oxocyclohex-2-en-1-yl]ethyl]-2-bicyclo[3.1.1]heptanyl] methylsulfanylmethanethioate |
|---|---|
| PubChem CID | 12047975 |
| Molecular Formula | C21H32O2S2 |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | O-[(1S,2S,4S,5S)-4,6,6-trimethyl-4-[2-[(1S)-1-methyl-4-oxocyclohex-2-en-1-yl]ethyl]-2-bicyclo[3.1.1]heptanyl] methylsulfanylmethanethioate |
| SMILES | CSC(=S)O[C@H]1C[C@](C)(CC[C@]2(C)C=CC(=O)CC2)[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C21H32O2S2/c1-19(2)15-12-17(19)21(4,13-16(15)23-18(24)25-5)11-10-20(3)8-6-14(22)7-9-20/h6,8,15-17H,7,9-13H2,1-5H3/t15-,16+,17-,20-,21+/m1/s1 |
| InChIKey | KQXQWVXFIUAFIO-WIRVCHQWSA-N |
| XLogP | 5.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|