About 3-ethylpentane
3-ethylpentane (PubChem CID 12048) has the molecular formula C7H16
and a molecular weight of 100.20 g/mol. Its IUPAC name is 3-ethylpentane.
Molecular Properties
| Compound Name | 3-ethylpentane |
| PubChem CID | 12048 |
| Molecular Formula | C7H16 |
| Molecular Weight | 100.20 g/mol |
| Exact Mass | 100.13 |
| IUPAC Name | 3-ethylpentane |
| SMILES | CCC(CC)CC |
| InChI | InChI=1S/C7H16/c1-4-7(5-2)6-3/h7H,4-6H2,1-3H3 |
| InChIKey | AORMDLNPRGXHHL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.20 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-ethylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylpentane?
The IUPAC name of 3-ethylpentane (CID 12048) is 3-ethylpentane.
What is the SMILES notation for 3-ethylpentane?
The canonical SMILES for 3-ethylpentane is CCC(CC)CC.
What is the InChIKey of 3-ethylpentane?
The InChIKey is AORMDLNPRGXHHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16/c1-4-7(5-2)6-3/h7H,4-6H2,1-3H3.
What are the key properties of 3-ethylpentane?
3-ethylpentane has a molecular weight of 100.20 g/mol, XLogP of 2.83, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylpentane is sourced from PubChem (CID 12048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).