About bis(propan-2-olate);titanium(2+)
bis(propan-2-olate);titanium(2+) (PubChem CID 12048820) has the molecular formula C6H14O2Ti
and a molecular weight of 166.04 g/mol. Its IUPAC name is bis(propan-2-olate);titanium(2+).
Molecular Properties
| Compound Name | bis(propan-2-olate);titanium(2+) |
| PubChem CID | 12048820 |
| Molecular Formula | C6H14O2Ti |
| Molecular Weight | 166.04 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | bis(propan-2-olate);titanium(2+) |
| SMILES | CC(C)[O-].CC(C)[O-].[Ti+2] |
| InChI | InChI=1S/2C3H7O.Ti/c2*1-3(2)4;/h2*3H,1-2H3;/q2*-1;+2 |
| InChIKey | JTQPTNQXCUMDRK-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.04 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(propan-2-olate);titanium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(propan-2-olate);titanium(2+)?
The IUPAC name of bis(propan-2-olate);titanium(2+) (CID 12048820) is bis(propan-2-olate);titanium(2+).
What is the SMILES notation for bis(propan-2-olate);titanium(2+)?
The canonical SMILES for bis(propan-2-olate);titanium(2+) is CC(C)[O-].CC(C)[O-].[Ti+2].
What is the InChIKey of bis(propan-2-olate);titanium(2+)?
The InChIKey is JTQPTNQXCUMDRK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H7O.Ti/c2*1-3(2)4;/h2*3H,1-2H3;/q2*-1;+2.
What are the key properties of bis(propan-2-olate);titanium(2+)?
bis(propan-2-olate);titanium(2+) has a molecular weight of 166.04 g/mol, XLogP of -0.49, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(propan-2-olate);titanium(2+) is sourced from PubChem (CID 12048820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).