C20H18O8 — CID 12049127
2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid (PubChem CID 12049127) has the molecular formula C20H18O8 and a molecular weight of 386.36 g/mol. Its IUPAC name is 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid.
| Compound Name | 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid |
|---|---|
| PubChem CID | 12049127 |
| Molecular Formula | C20H18O8 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid |
| SMILES | Cc1ccc(C(=O)C(O)(C(=O)O)C(O)(C(=O)O)C(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H18O8/c1-11-3-7-13(8-4-11)15(21)19(27,17(23)24)20(28,18(25)26)16(22)14-9-5-12(2)6-10-14/h3-10,27-28H,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | NTOIKDYVJIWVSU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|