2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid

C20H18O8 — CID 12049127

IUPAC2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid
SMILESCc1ccc(C(=O)C(O)(C(=O)O)C(O)(C(=O)O)C(=O)c2ccc(C)cc2)cc1
InChIInChI=1S/C20H18O8/c1-11-3-7-13(8-4-11)15(21)19(27,17(23)24)20(28,18(25)26)16(22)14-9-5-12(2)6-10-14/h3-10,27-28H,1-2H3,(H,23,24)(H,25,26)
InChIKeyNTOIKDYVJIWVSU-UHFFFAOYSA-N
MW386.36 g/mol
LogP1.00
Rot. Bonds7

About 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid

2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid (PubChem CID 12049127) has the molecular formula C20H18O8 and a molecular weight of 386.36 g/mol. Its IUPAC name is 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid.

Molecular Properties

Compound Name2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid
PubChem CID12049127
Molecular FormulaC20H18O8
Molecular Weight386.36 g/mol
Exact Mass386.10
IUPAC Name2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid
SMILESCc1ccc(C(=O)C(O)(C(=O)O)C(O)(C(=O)O)C(=O)c2ccc(C)cc2)cc1
InChIInChI=1S/C20H18O8/c1-11-3-7-13(8-4-11)15(21)19(27,17(23)24)20(28,18(25)26)16(22)14-9-5-12(2)6-10-14/h3-10,27-28H,1-2H3,(H,23,24)(H,25,26)
InChIKeyNTOIKDYVJIWVSU-UHFFFAOYSA-N
XLogP1.00
TPSA149.20 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds7
Heavy Atoms28
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500386.36
LogP ≤ 51.00
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid?
The IUPAC name of 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid (CID 12049127) is 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid.
What is the SMILES notation for 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid?
The canonical SMILES for 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid is Cc1ccc(C(=O)C(O)(C(=O)O)C(O)(C(=O)O)C(=O)c2ccc(C)cc2)cc1.
What is the InChIKey of 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid?
The InChIKey is NTOIKDYVJIWVSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18O8/c1-11-3-7-13(8-4-11)15(21)19(27,17(23)24)20(28,18(25)26)16(22)14-9-5-12(2)6-10-14/h3-10,27-28H,1-2H3,(H,23,24)(H,25,26).
What are the key properties of 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid?
2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid has a molecular weight of 386.36 g/mol, XLogP of 1.00, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid is sourced from PubChem (CID 12049127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).