C39H33N — CID 12049245
4-(3-methylphenyl)-N,N-bis[4-(3-methylphenyl)phenyl]aniline (PubChem CID 12049245) has the molecular formula C39H33N and a molecular weight of 515.70 g/mol. Its IUPAC name is 4-(3-methylphenyl)-N,N-bis[4-(3-methylphenyl)phenyl]aniline.
| Compound Name | 4-(3-methylphenyl)-N,N-bis[4-(3-methylphenyl)phenyl]aniline |
|---|---|
| PubChem CID | 12049245 |
| Molecular Formula | C39H33N |
| Molecular Weight | 515.70 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | 4-(3-methylphenyl)-N,N-bis[4-(3-methylphenyl)phenyl]aniline |
| SMILES | Cc1cccc(-c2ccc(N(c3ccc(-c4cccc(C)c4)cc3)c3ccc(-c4cccc(C)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C39H33N/c1-28-7-4-10-34(25-28)31-13-19-37(20-14-31)40(38-21-15-32(16-22-38)35-11-5-8-29(2)26-35)39-23-17-33(18-24-39)36-12-6-9-30(3)27-36/h4-27H,1-3H3 |
| InChIKey | KQOUFBMJMPCYFC-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.70 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |