About phthalate;bis(tetrabutylazanium)
phthalate;bis(tetrabutylazanium) (PubChem CID 12049480) has the molecular formula C40H76N2O4
and a molecular weight of 649.06 g/mol. Its IUPAC name is phthalate;bis(tetrabutylazanium).
Molecular Properties
| Compound Name | phthalate;bis(tetrabutylazanium) |
| PubChem CID | 12049480 |
| Molecular Formula | C40H76N2O4 |
| Molecular Weight | 649.06 g/mol |
| Exact Mass | 648.58 |
| IUPAC Name | phthalate;bis(tetrabutylazanium) |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC.O=C([O-])c1ccccc1C(=O)[O-] |
| InChI | InChI=1S/2C16H36N.C8H6O4/c2*1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;9-7(10)5-3-1-2-4-6(5)8(11)12/h2*5-16H2,1-4H3;1-4H,(H,9,10)(H,11,12)/q2*+1;/p-2 |
| InChIKey | NGJPFUZHXVGJDW-UHFFFAOYSA-L |
| XLogP | 8.42 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 649.06 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze phthalate;bis(tetrabutylazanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phthalate;bis(tetrabutylazanium)?
The IUPAC name of phthalate;bis(tetrabutylazanium) (CID 12049480) is phthalate;bis(tetrabutylazanium).
What is the SMILES notation for phthalate;bis(tetrabutylazanium)?
The canonical SMILES for phthalate;bis(tetrabutylazanium) is CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC.O=C([O-])c1ccccc1C(=O)[O-].
What is the InChIKey of phthalate;bis(tetrabutylazanium)?
The InChIKey is NGJPFUZHXVGJDW-UHFFFAOYSA-L. The full InChI is InChI=1S/2C16H36N.C8H6O4/c2*1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;9-7(10)5-3-1-2-4-6(5)8(11)12/h2*5-16H2,1-4H3;1-4H,(H,9,10)(H,11,12)/q2*+1;/p-2.
What are the key properties of phthalate;bis(tetrabutylazanium)?
phthalate;bis(tetrabutylazanium) has a molecular weight of 649.06 g/mol, XLogP of 8.42, 26 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phthalate;bis(tetrabutylazanium) is sourced from PubChem (CID 12049480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).