About ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-[(4-nitrobenzoyl)oxymethyl]triazole-4-carboxylate
ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-[(4-nitrobenzoyl)oxymethyl]triazole-4-carboxylate (PubChem CID 12049597) has the molecular formula C22H19N5O11
and a molecular weight of 529.42 g/mol. Its IUPAC name is ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-[(4-nitrobenzoyl)oxymethyl]triazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-[(4-nitrobenzoyl)oxymethyl]triazole-4-carboxylate |
| PubChem CID | 12049597 |
| Molecular Formula | C22H19N5O11 |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-[(4-nitrobenzoyl)oxymethyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nn(COC(=O)c2ccc([N+](=O)[O-])cc2)nc1C(=O)c1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H19N5O11/c1-4-37-22(30)19-18(20(28)14-9-16(35-2)17(36-3)10-15(14)27(33)34)23-25(24-19)11-38-21(29)12-5-7-13(8-6-12)26(31)32/h5-10H,4,11H2,1-3H3 |
| InChIKey | WJYPWIFGTVIPKH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 205.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-[(4-nitrobenzoyl)oxymethyl]triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-[(4-nitrobenzoyl)oxymethyl]triazole-4-carboxylate?
The IUPAC name of ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-[(4-nitrobenzoyl)oxymethyl]triazole-4-carboxylate (CID 12049597) is ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-[(4-nitrobenzoyl)oxymethyl]triazole-4-carboxylate.
What is the SMILES notation for ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-[(4-nitrobenzoyl)oxymethyl]triazole-4-carboxylate?
The canonical SMILES for ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-[(4-nitrobenzoyl)oxymethyl]triazole-4-carboxylate is CCOC(=O)c1nn(COC(=O)c2ccc([N+](=O)[O-])cc2)nc1C(=O)c1cc(OC)c(OC)cc1[N+](=O)[O-].
What is the InChIKey of ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-[(4-nitrobenzoyl)oxymethyl]triazole-4-carboxylate?
The InChIKey is WJYPWIFGTVIPKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N5O11/c1-4-37-22(30)19-18(20(28)14-9-16(35-2)17(36-3)10-15(14)27(33)34)23-25(24-19)11-38-21(29)12-5-7-13(8-6-12)26(31)32/h5-10H,4,11H2,1-3H3.
What are the key properties of ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-[(4-nitrobenzoyl)oxymethyl]triazole-4-carboxylate?
ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-[(4-nitrobenzoyl)oxymethyl]triazole-4-carboxylate has a molecular weight of 529.42 g/mol, XLogP of 2.33, 11 rotatable bonds, 0 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-[(4-nitrobenzoyl)oxymethyl]triazole-4-carboxylate is sourced from PubChem (CID 12049597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).