C16H27NO — CID 12049725
N-[2-[(2S,4aR,8S)-4a,8-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]propan-2-yl]formamide (PubChem CID 12049725) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is N-[2-[(2S,4aR,8S)-4a,8-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]propan-2-yl]formamide.
| Compound Name | N-[2-[(2S,4aR,8S)-4a,8-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]propan-2-yl]formamide |
|---|---|
| PubChem CID | 12049725 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | N-[2-[(2S,4aR,8S)-4a,8-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]propan-2-yl]formamide |
| SMILES | C[C@H]1CCC[C@]2(C)CC[C@H](C(C)(C)NC=O)C=C12 |
| InChI | InChI=1S/C16H27NO/c1-12-6-5-8-16(4)9-7-13(10-14(12)16)15(2,3)17-11-18/h10-13H,5-9H2,1-4H3,(H,17,18)/t12-,13-,16+/m0/s1 |
| InChIKey | XJNGSVNNIXUPGR-HEHGZKQESA-N |
| XLogP | 3.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|