C33H48O5Si — CID 12049768
(8S)-8-[tert-butyl(diphenyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxydodec-11-en-6-one (PubChem CID 12049768) has the molecular formula C33H48O5Si and a molecular weight of 552.83 g/mol. Its IUPAC name is (8S)-8-[tert-butyl(diphenyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxydodec-11-en-6-one.
| Compound Name | (8S)-8-[tert-butyl(diphenyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxydodec-11-en-6-one |
|---|---|
| PubChem CID | 12049768 |
| Molecular Formula | C33H48O5Si |
| Molecular Weight | 552.83 g/mol |
| Exact Mass | 552.33 |
| IUPAC Name | (8S)-8-[tert-butyl(diphenyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxydodec-11-en-6-one |
| SMILES | C=CCC[C@@H](CC(=O)CC(O)CCC[C@@H]1COC(C)(C)O1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H48O5Si/c1-7-8-17-28(24-27(35)23-26(34)16-15-18-29-25-36-33(5,6)37-29)38-39(32(2,3)4,30-19-11-9-12-20-30)31-21-13-10-14-22-31/h7,9-14,19-22,26,28-29,34H,1,8,15-18,23-25H2,2-6H3/t26?,28-,29+/m0/s1 |
| InChIKey | VMINUYQNXHNLLU-GXRAEGJDSA-N |
| XLogP | 5.93 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.83 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|