C14H19FO2 — CID 12049793
(Z,2R,5S)-4-fluoro-2-methyl-7-phenylhept-3-ene-1,5-diol (PubChem CID 12049793) has the molecular formula C14H19FO2 and a molecular weight of 238.30 g/mol. Its IUPAC name is (Z,2R,5S)-4-fluoro-2-methyl-7-phenylhept-3-ene-1,5-diol.
| Compound Name | (Z,2R,5S)-4-fluoro-2-methyl-7-phenylhept-3-ene-1,5-diol |
|---|---|
| PubChem CID | 12049793 |
| Molecular Formula | C14H19FO2 |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | (Z,2R,5S)-4-fluoro-2-methyl-7-phenylhept-3-ene-1,5-diol |
| SMILES | C[C@H](/C=C(\F)[C@@H](O)CCc1ccccc1)CO |
| InChI | InChI=1S/C14H19FO2/c1-11(10-16)9-13(15)14(17)8-7-12-5-3-2-4-6-12/h2-6,9,11,14,16-17H,7-8,10H2,1H3/b13-9-/t11-,14+/m1/s1 |
| InChIKey | QLUYVMQBCJJZQM-SYKXKWPBSA-N |
| XLogP | 2.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |