About N-[2-(4-methylsulfonylphenyl)ethyl]-N'-(2-pyridin-3-ylethyl)hexane-1,6-diamine
N-[2-(4-methylsulfonylphenyl)ethyl]-N'-(2-pyridin-3-ylethyl)hexane-1,6-diamine (PubChem CID 12049901) has the molecular formula C22H33N3O2S
and a molecular weight of 403.59 g/mol. Its IUPAC name is N-[2-(4-methylsulfonylphenyl)ethyl]-N'-(2-pyridin-3-ylethyl)hexane-1,6-diamine.
Molecular Properties
| Compound Name | N-[2-(4-methylsulfonylphenyl)ethyl]-N'-(2-pyridin-3-ylethyl)hexane-1,6-diamine |
| PubChem CID | 12049901 |
| Molecular Formula | C22H33N3O2S |
| Molecular Weight | 403.59 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | N-[2-(4-methylsulfonylphenyl)ethyl]-N'-(2-pyridin-3-ylethyl)hexane-1,6-diamine |
| SMILES | CS(=O)(=O)c1ccc(CCNCCCCCCNCCc2cccnc2)cc1 |
| InChI | InChI=1S/C22H33N3O2S/c1-28(26,27)22-10-8-20(9-11-22)12-17-23-14-4-2-3-5-15-24-18-13-21-7-6-16-25-19-21/h6-11,16,19,23-24H,2-5,12-15,17-18H2,1H3 |
| InChIKey | ASWXZDROVNDMIN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.59 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(4-methylsulfonylphenyl)ethyl]-N'-(2-pyridin-3-ylethyl)hexane-1,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-methylsulfonylphenyl)ethyl]-N'-(2-pyridin-3-ylethyl)hexane-1,6-diamine?
The IUPAC name of N-[2-(4-methylsulfonylphenyl)ethyl]-N'-(2-pyridin-3-ylethyl)hexane-1,6-diamine (CID 12049901) is N-[2-(4-methylsulfonylphenyl)ethyl]-N'-(2-pyridin-3-ylethyl)hexane-1,6-diamine.
What is the SMILES notation for N-[2-(4-methylsulfonylphenyl)ethyl]-N'-(2-pyridin-3-ylethyl)hexane-1,6-diamine?
The canonical SMILES for N-[2-(4-methylsulfonylphenyl)ethyl]-N'-(2-pyridin-3-ylethyl)hexane-1,6-diamine is CS(=O)(=O)c1ccc(CCNCCCCCCNCCc2cccnc2)cc1.
What is the InChIKey of N-[2-(4-methylsulfonylphenyl)ethyl]-N'-(2-pyridin-3-ylethyl)hexane-1,6-diamine?
The InChIKey is ASWXZDROVNDMIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H33N3O2S/c1-28(26,27)22-10-8-20(9-11-22)12-17-23-14-4-2-3-5-15-24-18-13-21-7-6-16-25-19-21/h6-11,16,19,23-24H,2-5,12-15,17-18H2,1H3.
What are the key properties of N-[2-(4-methylsulfonylphenyl)ethyl]-N'-(2-pyridin-3-ylethyl)hexane-1,6-diamine?
N-[2-(4-methylsulfonylphenyl)ethyl]-N'-(2-pyridin-3-ylethyl)hexane-1,6-diamine has a molecular weight of 403.59 g/mol, XLogP of 3.01, 14 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-methylsulfonylphenyl)ethyl]-N'-(2-pyridin-3-ylethyl)hexane-1,6-diamine is sourced from PubChem (CID 12049901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).