About 3-amino-N-(1,4-dimethylcyclohexyl)-2-methylbutanamide;hydrochloride
3-amino-N-(1,4-dimethylcyclohexyl)-2-methylbutanamide;hydrochloride (PubChem CID 120500050) has the molecular formula C13H27ClN2O
and a molecular weight of 262.82 g/mol. Its IUPAC name is 3-amino-N-(1,4-dimethylcyclohexyl)-2-methylbutanamide;hydrochloride.
Molecular Properties
| Compound Name | 3-amino-N-(1,4-dimethylcyclohexyl)-2-methylbutanamide;hydrochloride |
| PubChem CID | 120500050 |
| Molecular Formula | C13H27ClN2O |
| Molecular Weight | 262.82 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 3-amino-N-(1,4-dimethylcyclohexyl)-2-methylbutanamide;hydrochloride |
| SMILES | CC1CCC(C)(NC(=O)C(C)C(C)N)CC1.Cl |
| InChI | InChI=1S/C13H26N2O.ClH/c1-9-5-7-13(4,8-6-9)15-12(16)10(2)11(3)14;/h9-11H,5-8,14H2,1-4H3,(H,15,16);1H |
| InChIKey | CIIMWXUJIFCNRH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.82 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-N-(1,4-dimethylcyclohexyl)-2-methylbutanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-(1,4-dimethylcyclohexyl)-2-methylbutanamide;hydrochloride?
The IUPAC name of 3-amino-N-(1,4-dimethylcyclohexyl)-2-methylbutanamide;hydrochloride (CID 120500050) is 3-amino-N-(1,4-dimethylcyclohexyl)-2-methylbutanamide;hydrochloride.
What is the SMILES notation for 3-amino-N-(1,4-dimethylcyclohexyl)-2-methylbutanamide;hydrochloride?
The canonical SMILES for 3-amino-N-(1,4-dimethylcyclohexyl)-2-methylbutanamide;hydrochloride is CC1CCC(C)(NC(=O)C(C)C(C)N)CC1.Cl.
What is the InChIKey of 3-amino-N-(1,4-dimethylcyclohexyl)-2-methylbutanamide;hydrochloride?
The InChIKey is CIIMWXUJIFCNRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O.ClH/c1-9-5-7-13(4,8-6-9)15-12(16)10(2)11(3)14;/h9-11H,5-8,14H2,1-4H3,(H,15,16);1H.
What are the key properties of 3-amino-N-(1,4-dimethylcyclohexyl)-2-methylbutanamide;hydrochloride?
3-amino-N-(1,4-dimethylcyclohexyl)-2-methylbutanamide;hydrochloride has a molecular weight of 262.82 g/mol, XLogP of 2.48, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-(1,4-dimethylcyclohexyl)-2-methylbutanamide;hydrochloride is sourced from PubChem (CID 120500050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).