C19H31ClN2O — CID 120500104
3-amino-2-methyl-N-[[1-(2-methylphenyl)cyclohexyl]methyl]butanamide;hydrochloride (PubChem CID 120500104) has the molecular formula C19H31ClN2O and a molecular weight of 338.92 g/mol. Its IUPAC name is 3-amino-2-methyl-N-[[1-(2-methylphenyl)cyclohexyl]methyl]butanamide;hydrochloride.
| Compound Name | 3-amino-2-methyl-N-[[1-(2-methylphenyl)cyclohexyl]methyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 120500104 |
| Molecular Formula | C19H31ClN2O |
| Molecular Weight | 338.92 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 3-amino-2-methyl-N-[[1-(2-methylphenyl)cyclohexyl]methyl]butanamide;hydrochloride |
| SMILES | Cc1ccccc1C1(CNC(=O)C(C)C(C)N)CCCCC1.Cl |
| InChI | InChI=1S/C19H30N2O.ClH/c1-14-9-5-6-10-17(14)19(11-7-4-8-12-19)13-21-18(22)15(2)16(3)20;/h5-6,9-10,15-16H,4,7-8,11-13,20H2,1-3H3,(H,21,22);1H |
| InChIKey | CAMWEVGKPPJSAP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.92 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |