About 2-benzyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene
2-benzyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene (PubChem CID 12050040) has the molecular formula C18H23N
and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-benzyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene.
Molecular Properties
| Compound Name | 2-benzyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene |
| PubChem CID | 12050040 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 2-benzyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene |
| SMILES | c1ccc(CC2CCCCCCc3cc2c[nH]3)cc1 |
| InChI | InChI=1S/C18H23N/c1-2-7-11-18-13-17(14-19-18)16(10-6-1)12-15-8-4-3-5-9-15/h3-5,8-9,13-14,16,19H,1-2,6-7,10-12H2 |
| InChIKey | ZGVGAMSSHFILQD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-benzyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene?
The IUPAC name of 2-benzyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene (CID 12050040) is 2-benzyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene.
What is the SMILES notation for 2-benzyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene?
The canonical SMILES for 2-benzyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene is c1ccc(CC2CCCCCCc3cc2c[nH]3)cc1.
What is the InChIKey of 2-benzyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene?
The InChIKey is ZGVGAMSSHFILQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N/c1-2-7-11-18-13-17(14-19-18)16(10-6-1)12-15-8-4-3-5-9-15/h3-5,8-9,13-14,16,19H,1-2,6-7,10-12H2.
What are the key properties of 2-benzyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene?
2-benzyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene has a molecular weight of 253.39 g/mol, XLogP of 4.85, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene is sourced from PubChem (CID 12050040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).