C18H22Cl2N2O2 — CID 120501253
3-amino-N-[2-[(3-chlorophenyl)methoxy]phenyl]-2-methylbutanamide;hydrochloride (PubChem CID 120501253) has the molecular formula C18H22Cl2N2O2 and a molecular weight of 369.29 g/mol. Its IUPAC name is 3-amino-N-[2-[(3-chlorophenyl)methoxy]phenyl]-2-methylbutanamide;hydrochloride.
| Compound Name | 3-amino-N-[2-[(3-chlorophenyl)methoxy]phenyl]-2-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 120501253 |
| Molecular Formula | C18H22Cl2N2O2 |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 3-amino-N-[2-[(3-chlorophenyl)methoxy]phenyl]-2-methylbutanamide;hydrochloride |
| SMILES | CC(N)C(C)C(=O)Nc1ccccc1OCc1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C18H21ClN2O2.ClH/c1-12(13(2)20)18(22)21-16-8-3-4-9-17(16)23-11-14-6-5-7-15(19)10-14;/h3-10,12-13H,11,20H2,1-2H3,(H,21,22);1H |
| InChIKey | PTUIETVZAATJJT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |