C27H36N4O5 — CID 12050170
diethyl 2-[1-(2-methylpyrimidin-5-yl)-3-oxo-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)heptyl]propanedioate (PubChem CID 12050170) has the molecular formula C27H36N4O5 and a molecular weight of 496.61 g/mol. Its IUPAC name is diethyl 2-[1-(2-methylpyrimidin-5-yl)-3-oxo-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)heptyl]propanedioate.
| Compound Name | diethyl 2-[1-(2-methylpyrimidin-5-yl)-3-oxo-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)heptyl]propanedioate |
|---|---|
| PubChem CID | 12050170 |
| Molecular Formula | C27H36N4O5 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | diethyl 2-[1-(2-methylpyrimidin-5-yl)-3-oxo-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)heptyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(CC(=O)CCCCc1ccc2c(n1)NCCC2)c1cnc(C)nc1 |
| InChI | InChI=1S/C27H36N4O5/c1-4-35-26(33)24(27(34)36-5-2)23(20-16-29-18(3)30-17-20)15-22(32)11-7-6-10-21-13-12-19-9-8-14-28-25(19)31-21/h12-13,16-17,23-24H,4-11,14-15H2,1-3H3,(H,28,31) |
| InChIKey | YUWNSIYURLXKHP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|