About 1-benzyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]piperidin-4-amine
1-benzyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]piperidin-4-amine (PubChem CID 12050198) has the molecular formula C22H25N3O
and a molecular weight of 347.46 g/mol. Its IUPAC name is 1-benzyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]piperidin-4-amine.
Molecular Properties
| Compound Name | 1-benzyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]piperidin-4-amine |
| PubChem CID | 12050198 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 1-benzyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]piperidin-4-amine |
| SMILES | c1ccc(CN2CCC(NCc3coc(-c4ccccc4)n3)CC2)cc1 |
| InChI | InChI=1S/C22H25N3O/c1-3-7-18(8-4-1)16-25-13-11-20(12-14-25)23-15-21-17-26-22(24-21)19-9-5-2-6-10-19/h1-10,17,20,23H,11-16H2 |
| InChIKey | NCKGSESQGZBZQN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-benzyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]piperidin-4-amine?
The IUPAC name of 1-benzyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]piperidin-4-amine (CID 12050198) is 1-benzyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]piperidin-4-amine.
What is the SMILES notation for 1-benzyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]piperidin-4-amine?
The canonical SMILES for 1-benzyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]piperidin-4-amine is c1ccc(CN2CCC(NCc3coc(-c4ccccc4)n3)CC2)cc1.
What is the InChIKey of 1-benzyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]piperidin-4-amine?
The InChIKey is NCKGSESQGZBZQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O/c1-3-7-18(8-4-1)16-25-13-11-20(12-14-25)23-15-21-17-26-22(24-21)19-9-5-2-6-10-19/h1-10,17,20,23H,11-16H2.
What are the key properties of 1-benzyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]piperidin-4-amine?
1-benzyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]piperidin-4-amine has a molecular weight of 347.46 g/mol, XLogP of 4.10, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]piperidin-4-amine is sourced from PubChem (CID 12050198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).