About 3-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-2-methylbutanamide;hydrochloride
3-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-2-methylbutanamide;hydrochloride (PubChem CID 120502331) has the molecular formula C13H24ClN3O2
and a molecular weight of 289.81 g/mol. Its IUPAC name is 3-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-2-methylbutanamide;hydrochloride.
Molecular Properties
| Compound Name | 3-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-2-methylbutanamide;hydrochloride |
| PubChem CID | 120502331 |
| Molecular Formula | C13H24ClN3O2 |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 3-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-2-methylbutanamide;hydrochloride |
| SMILES | CCc1noc(CC)c1CNC(=O)C(C)C(C)N.Cl |
| InChI | InChI=1S/C13H23N3O2.ClH/c1-5-11-10(12(6-2)18-16-11)7-15-13(17)8(3)9(4)14;/h8-9H,5-7,14H2,1-4H3,(H,15,17);1H |
| InChIKey | OXHYQMFMEXECGB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-2-methylbutanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-2-methylbutanamide;hydrochloride?
The IUPAC name of 3-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-2-methylbutanamide;hydrochloride (CID 120502331) is 3-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-2-methylbutanamide;hydrochloride.
What is the SMILES notation for 3-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-2-methylbutanamide;hydrochloride?
The canonical SMILES for 3-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-2-methylbutanamide;hydrochloride is CCc1noc(CC)c1CNC(=O)C(C)C(C)N.Cl.
What is the InChIKey of 3-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-2-methylbutanamide;hydrochloride?
The InChIKey is OXHYQMFMEXECGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O2.ClH/c1-5-11-10(12(6-2)18-16-11)7-15-13(17)8(3)9(4)14;/h8-9H,5-7,14H2,1-4H3,(H,15,17);1H.
What are the key properties of 3-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-2-methylbutanamide;hydrochloride?
3-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-2-methylbutanamide;hydrochloride has a molecular weight of 289.81 g/mol, XLogP of 1.82, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-2-methylbutanamide;hydrochloride is sourced from PubChem (CID 120502331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).