C16H27Cl2N3O2 — CID 120502403
3-amino-1-[4-(2-methoxyphenyl)piperazin-1-yl]-2-methylbutan-1-one;dihydrochloride (PubChem CID 120502403) has the molecular formula C16H27Cl2N3O2 and a molecular weight of 364.32 g/mol. Its IUPAC name is 3-amino-1-[4-(2-methoxyphenyl)piperazin-1-yl]-2-methylbutan-1-one;dihydrochloride.
| Compound Name | 3-amino-1-[4-(2-methoxyphenyl)piperazin-1-yl]-2-methylbutan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 120502403 |
| Molecular Formula | C16H27Cl2N3O2 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 3-amino-1-[4-(2-methoxyphenyl)piperazin-1-yl]-2-methylbutan-1-one;dihydrochloride |
| SMILES | COc1ccccc1N1CCN(C(=O)C(C)C(C)N)CC1.Cl.Cl |
| InChI | InChI=1S/C16H25N3O2.2ClH/c1-12(13(2)17)16(20)19-10-8-18(9-11-19)14-6-4-5-7-15(14)21-3;;/h4-7,12-13H,8-11,17H2,1-3H3;2*1H |
| InChIKey | QKWKIYSFUVFVLR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |