C12H24Cl2N4O — CID 120503214
3-amino-N-(3-imidazol-1-yl-2-methylpropyl)-2-methylbutanamide;dihydrochloride (PubChem CID 120503214) has the molecular formula C12H24Cl2N4O and a molecular weight of 311.26 g/mol. Its IUPAC name is 3-amino-N-(3-imidazol-1-yl-2-methylpropyl)-2-methylbutanamide;dihydrochloride.
| Compound Name | 3-amino-N-(3-imidazol-1-yl-2-methylpropyl)-2-methylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 120503214 |
| Molecular Formula | C12H24Cl2N4O |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 3-amino-N-(3-imidazol-1-yl-2-methylpropyl)-2-methylbutanamide;dihydrochloride |
| SMILES | CC(CNC(=O)C(C)C(C)N)Cn1ccnc1.Cl.Cl |
| InChI | InChI=1S/C12H22N4O.2ClH/c1-9(7-16-5-4-14-8-16)6-15-12(17)10(2)11(3)13;;/h4-5,8-11H,6-7,13H2,1-3H3,(H,15,17);2*1H |
| InChIKey | RVGWCRGOMLCFAN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |