C17H29N3O2 — CID 120503727
3-amino-N-[[4-[3-(dimethylamino)propoxy]phenyl]methyl]-2-methylbutanamide (PubChem CID 120503727) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 3-amino-N-[[4-[3-(dimethylamino)propoxy]phenyl]methyl]-2-methylbutanamide.
| Compound Name | 3-amino-N-[[4-[3-(dimethylamino)propoxy]phenyl]methyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 120503727 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 3-amino-N-[[4-[3-(dimethylamino)propoxy]phenyl]methyl]-2-methylbutanamide |
| SMILES | CC(N)C(C)C(=O)NCc1ccc(OCCCN(C)C)cc1 |
| InChI | InChI=1S/C17H29N3O2/c1-13(14(2)18)17(21)19-12-15-6-8-16(9-7-15)22-11-5-10-20(3)4/h6-9,13-14H,5,10-12,18H2,1-4H3,(H,19,21) |
| InChIKey | RRCQPCMAERIDHO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|