C34H42N4O3 — CID 12050400
N,N-diethyl-4-[[2-[4-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]butoxy]phenyl]methyl]benzamide (PubChem CID 12050400) has the molecular formula C34H42N4O3 and a molecular weight of 554.74 g/mol. Its IUPAC name is N,N-diethyl-4-[[2-[4-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]butoxy]phenyl]methyl]benzamide.
| Compound Name | N,N-diethyl-4-[[2-[4-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]butoxy]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 12050400 |
| Molecular Formula | C34H42N4O3 |
| Molecular Weight | 554.74 g/mol |
| Exact Mass | 554.33 |
| IUPAC Name | N,N-diethyl-4-[[2-[4-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]butoxy]phenyl]methyl]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(Cc2ccccc2OCCCCN2CCC(n3c(=O)[nH]c4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C34H42N4O3/c1-3-37(4-2)33(39)27-17-15-26(16-18-27)25-28-11-5-8-14-32(28)41-24-10-9-21-36-22-19-29(20-23-36)38-31-13-7-6-12-30(31)35-34(38)40/h5-8,11-18,29H,3-4,9-10,19-25H2,1-2H3,(H,35,40) |
| InChIKey | ZHSNEDOXNBNOQP-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 70.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.74 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|