C46H38N6O6 — CID 12050539
trans-(3R,12R)-3,12-bis(pyren-1-ylmethyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone (PubChem CID 12050539) has the molecular formula C46H38N6O6 and a molecular weight of 770.85 g/mol. Its IUPAC name is trans-(3R,12R)-3,12-bis(pyren-1-ylmethyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone.
| Compound Name | trans-(3R,12R)-3,12-bis(pyren-1-ylmethyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |
|---|---|
| PubChem CID | 12050539 |
| Molecular Formula | C46H38N6O6 |
| Molecular Weight | 770.85 g/mol |
| Exact Mass | 770.29 |
| IUPAC Name | trans-(3R,12R)-3,12-bis(pyren-1-ylmethyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |
| SMILES | O=C1CNC(=O)[C@@H](Cc2ccc3ccc4cccc5ccc2c3c45)NC(=O)CNC(=O)CNC(=O)[C@@H](Cc2ccc3ccc4cccc5ccc2c3c45)NC(=O)CN1 |
| InChI | InChI=1S/C46H38N6O6/c53-37-21-49-45(57)35(19-31-13-11-29-9-7-25-3-1-5-27-15-17-33(31)43(29)41(25)27)51-39(55)23-47-38(54)22-50-46(58)36(52-40(56)24-48-37)20-32-14-12-30-10-8-26-4-2-6-28-16-18-34(32)44(30)42(26)28/h1-18,35-36H,19-24H2,(H,47,54)(H,48,53)(H,49,57)(H,50,58)(H,51,55)(H,52,56)/t35-,36-/m1/s1 |
| InChIKey | PZZISZPFQWJHTO-LQFQNGICSA-N |
| XLogP | 3.71 |
| TPSA | 174.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.85 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|