C29H28N6O6 — CID 12050540
(3R)-3-(pyren-1-ylmethyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone (PubChem CID 12050540) has the molecular formula C29H28N6O6 and a molecular weight of 556.58 g/mol. Its IUPAC name is (3R)-3-(pyren-1-ylmethyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone.
| Compound Name | (3R)-3-(pyren-1-ylmethyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |
|---|---|
| PubChem CID | 12050540 |
| Molecular Formula | C29H28N6O6 |
| Molecular Weight | 556.58 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | (3R)-3-(pyren-1-ylmethyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |
| SMILES | O=C1CNC(=O)CNC(=O)CNC(=O)[C@@H](Cc2ccc3ccc4cccc5ccc2c3c45)NC(=O)CNC(=O)CN1 |
| InChI | InChI=1S/C29H28N6O6/c36-22-11-30-23(37)12-32-25(39)14-34-29(41)21(35-26(40)15-33-24(38)13-31-22)10-19-7-6-18-5-4-16-2-1-3-17-8-9-20(19)28(18)27(16)17/h1-9,21H,10-15H2,(H,30,37)(H,31,36)(H,32,39)(H,33,38)(H,34,41)(H,35,40)/t21-/m1/s1 |
| InChIKey | YPVZFEMXTHVCMX-OAQYLSRUSA-N |
| XLogP | -0.79 |
| TPSA | 174.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.58 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|