C11H15IN2O — CID 120505769
N-[(2S)-1-aminopropan-2-yl]-2-(3-iodophenyl)acetamide (PubChem CID 120505769) has the molecular formula C11H15IN2O and a molecular weight of 318.16 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-2-(3-iodophenyl)acetamide.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-2-(3-iodophenyl)acetamide |
|---|---|
| PubChem CID | 120505769 |
| Molecular Formula | C11H15IN2O |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-2-(3-iodophenyl)acetamide |
| SMILES | C[C@@H](CN)NC(=O)Cc1cccc(I)c1 |
| InChI | InChI=1S/C11H15IN2O/c1-8(7-13)14-11(15)6-9-3-2-4-10(12)5-9/h2-5,8H,6-7,13H2,1H3,(H,14,15)/t8-/m0/s1 |
| InChIKey | ARYDITUYIUBUMD-QMMMGPOBSA-N |
| XLogP | 1.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|