About ethyl 2,6-dioxo-1-propyl-3H-pyridine-4-carboxylate
ethyl 2,6-dioxo-1-propyl-3H-pyridine-4-carboxylate (PubChem CID 12050762) has the molecular formula C11H15NO4
and a molecular weight of 225.24 g/mol. Its IUPAC name is ethyl 2,6-dioxo-1-propyl-3H-pyridine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 2,6-dioxo-1-propyl-3H-pyridine-4-carboxylate |
| PubChem CID | 12050762 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | ethyl 2,6-dioxo-1-propyl-3H-pyridine-4-carboxylate |
| SMILES | CCCN1C(=O)C=C(C(=O)OCC)CC1=O |
| InChI | InChI=1S/C11H15NO4/c1-3-5-12-9(13)6-8(7-10(12)14)11(15)16-4-2/h6H,3-5,7H2,1-2H3 |
| InChIKey | WLSGVPBAJTXCPO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2,6-dioxo-1-propyl-3H-pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2,6-dioxo-1-propyl-3H-pyridine-4-carboxylate?
The IUPAC name of ethyl 2,6-dioxo-1-propyl-3H-pyridine-4-carboxylate (CID 12050762) is ethyl 2,6-dioxo-1-propyl-3H-pyridine-4-carboxylate.
What is the SMILES notation for ethyl 2,6-dioxo-1-propyl-3H-pyridine-4-carboxylate?
The canonical SMILES for ethyl 2,6-dioxo-1-propyl-3H-pyridine-4-carboxylate is CCCN1C(=O)C=C(C(=O)OCC)CC1=O.
What is the InChIKey of ethyl 2,6-dioxo-1-propyl-3H-pyridine-4-carboxylate?
The InChIKey is WLSGVPBAJTXCPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO4/c1-3-5-12-9(13)6-8(7-10(12)14)11(15)16-4-2/h6H,3-5,7H2,1-2H3.
What are the key properties of ethyl 2,6-dioxo-1-propyl-3H-pyridine-4-carboxylate?
ethyl 2,6-dioxo-1-propyl-3H-pyridine-4-carboxylate has a molecular weight of 225.24 g/mol, XLogP of 0.64, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,6-dioxo-1-propyl-3H-pyridine-4-carboxylate is sourced from PubChem (CID 12050762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).