C18H29N3O3S — CID 120507976
N-[(2S)-1-aminopropan-2-yl]-1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 120507976) has the molecular formula C18H29N3O3S and a molecular weight of 367.52 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120507976 |
| Molecular Formula | C18H29N3O3S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | CC(C)c1ccc(S(=O)(=O)N2CCC(C(=O)N[C@@H](C)CN)CC2)cc1 |
| InChI | InChI=1S/C18H29N3O3S/c1-13(2)15-4-6-17(7-5-15)25(23,24)21-10-8-16(9-11-21)18(22)20-14(3)12-19/h4-7,13-14,16H,8-12,19H2,1-3H3,(H,20,22)/t14-/m0/s1 |
| InChIKey | VYLSSBJFBMZGLE-AWEZNQCLSA-N |
| XLogP | 1.67 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |