C17H23NO3 — CID 120509651
4-[[(E)-3-(2-methoxyphenyl)prop-2-enyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 120509651) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 4-[[(E)-3-(2-methoxyphenyl)prop-2-enyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[(E)-3-(2-methoxyphenyl)prop-2-enyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120509651 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 4-[[(E)-3-(2-methoxyphenyl)prop-2-enyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | COc1ccccc1/C=C/CNC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C17H23NO3/c1-21-16-7-3-2-5-13(16)6-4-12-18-15-10-8-14(9-11-15)17(19)20/h2-7,14-15,18H,8-12H2,1H3,(H,19,20)/b6-4+ |
| InChIKey | SRJSDRQOPHDFOW-GQCTYLIASA-N |
| XLogP | 2.94 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |