C18H27NO4 — CID 120509883
4-[[3-(3-methoxypropoxy)phenyl]methylamino]cyclohexane-1-carboxylic acid (PubChem CID 120509883) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is 4-[[3-(3-methoxypropoxy)phenyl]methylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[3-(3-methoxypropoxy)phenyl]methylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120509883 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 4-[[3-(3-methoxypropoxy)phenyl]methylamino]cyclohexane-1-carboxylic acid |
| SMILES | COCCCOc1cccc(CNC2CCC(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C18H27NO4/c1-22-10-3-11-23-17-5-2-4-14(12-17)13-19-16-8-6-15(7-9-16)18(20)21/h2,4-5,12,15-16,19H,3,6-11,13H2,1H3,(H,20,21) |
| InChIKey | FLUAIDMXPPXNMQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|