C16H18ClFN4O2 — CID 120509901
4-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methylamino]cyclohexane-1-carboxylic acid (PubChem CID 120509901) has the molecular formula C16H18ClFN4O2 and a molecular weight of 352.80 g/mol. Its IUPAC name is 4-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120509901 |
| Molecular Formula | C16H18ClFN4O2 |
| Molecular Weight | 352.80 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 4-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NCc2cn(-c3ccc(F)c(Cl)c3)nn2)CC1 |
| InChI | InChI=1S/C16H18ClFN4O2/c17-14-7-13(5-6-15(14)18)22-9-12(20-21-22)8-19-11-3-1-10(2-4-11)16(23)24/h5-7,9-11,19H,1-4,8H2,(H,23,24) |
| InChIKey | UJJDTIDBGCZYRH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.80 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |