C16H23NO4 — CID 120510206
2-(3,4-dihydro-2H-1,5-benzodioxepin-6-ylmethylamino)hexanoic acid (PubChem CID 120510206) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-1,5-benzodioxepin-6-ylmethylamino)hexanoic acid.
| Compound Name | 2-(3,4-dihydro-2H-1,5-benzodioxepin-6-ylmethylamino)hexanoic acid |
|---|---|
| PubChem CID | 120510206 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2-(3,4-dihydro-2H-1,5-benzodioxepin-6-ylmethylamino)hexanoic acid |
| SMILES | CCCCC(NCc1cccc2c1OCCCO2)C(=O)O |
| InChI | InChI=1S/C16H23NO4/c1-2-3-7-13(16(18)19)17-11-12-6-4-8-14-15(12)21-10-5-9-20-14/h4,6,8,13,17H,2-3,5,7,9-11H2,1H3,(H,18,19) |
| InChIKey | ZJJIHZACIPAPJK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |