C16H19ClN2O2 — CID 120510435
(2S,3S)-2-[(6-chloroquinolin-8-yl)methylamino]-3-methylpentanoic acid (PubChem CID 120510435) has the molecular formula C16H19ClN2O2 and a molecular weight of 306.79 g/mol. Its IUPAC name is (2S,3S)-2-[(6-chloroquinolin-8-yl)methylamino]-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-[(6-chloroquinolin-8-yl)methylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 120510435 |
| Molecular Formula | C16H19ClN2O2 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | (2S,3S)-2-[(6-chloroquinolin-8-yl)methylamino]-3-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@H](NCc1cc(Cl)cc2cccnc12)C(=O)O |
| InChI | InChI=1S/C16H19ClN2O2/c1-3-10(2)14(16(20)21)19-9-12-8-13(17)7-11-5-4-6-18-15(11)12/h4-8,10,14,19H,3,9H2,1-2H3,(H,20,21)/t10-,14-/m0/s1 |
| InChIKey | CWVRNBITXJCGFI-HZMBPMFUSA-N |
| XLogP | 3.48 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |