C15H23NO2 — CID 120510814
(2S)-2-[(2,5-dimethylphenyl)methylamino]-4-methylpentanoic acid (PubChem CID 120510814) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is (2S)-2-[(2,5-dimethylphenyl)methylamino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[(2,5-dimethylphenyl)methylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 120510814 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | (2S)-2-[(2,5-dimethylphenyl)methylamino]-4-methylpentanoic acid |
| SMILES | Cc1ccc(C)c(CN[C@@H](CC(C)C)C(=O)O)c1 |
| InChI | InChI=1S/C15H23NO2/c1-10(2)7-14(15(17)18)16-9-13-8-11(3)5-6-12(13)4/h5-6,8,10,14,16H,7,9H2,1-4H3,(H,17,18)/t14-/m0/s1 |
| InChIKey | AUGNJJKJPIJHLP-AWEZNQCLSA-N |
| XLogP | 2.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |