C34H26N6O2 — CID 12051109
22-[6-(2,5-dimethylpyrrol-1-yl)-2-pyridinyl]-2,5,23,26-tetrazahexacyclo[12.12.0.03,12.04,9.016,25.019,24]hexacosa-1(26),2,4(9),5,7,12,14,16(25),19(24),20,22-undecaene-6-carboxylic acid (PubChem CID 12051109) has the molecular formula C34H26N6O2 and a molecular weight of 550.62 g/mol. Its IUPAC name is 22-[6-(2,5-dimethylpyrrol-1-yl)-2-pyridinyl]-2,5,23,26-tetrazahexacyclo[12.12.0.03,12.04,9.016,25.019,24]hexacosa-1(26),2,4(9),5,7,12,14,16(25),19(24),20,22-undecaene-6-carboxylic acid.
| Compound Name | 22-[6-(2,5-dimethylpyrrol-1-yl)-2-pyridinyl]-2,5,23,26-tetrazahexacyclo[12.12.0.03,12.04,9.016,25.019,24]hexacosa-1(26),2,4(9),5,7,12,14,16(25),19(24),20,22-undecaene-6-carboxylic acid |
|---|---|
| PubChem CID | 12051109 |
| Molecular Formula | C34H26N6O2 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | 22-[6-(2,5-dimethylpyrrol-1-yl)-2-pyridinyl]-2,5,23,26-tetrazahexacyclo[12.12.0.03,12.04,9.016,25.019,24]hexacosa-1(26),2,4(9),5,7,12,14,16(25),19(24),20,22-undecaene-6-carboxylic acid |
| SMILES | Cc1ccc(C)n1-c1cccc(-c2ccc3c(n2)-c2nc4nc5c(cc4cc2CC3)CCc2ccc(C(=O)O)nc2-5)n1 |
| InChI | InChI=1S/C34H26N6O2/c1-18-6-7-19(2)40(18)28-5-3-4-25(35-28)26-14-12-20-8-10-22-16-24-17-23-11-9-21-13-15-27(34(41)42)37-30(21)32(23)39-33(24)38-31(22)29(20)36-26/h3-7,12-17H,8-11H2,1-2H3,(H,41,42) |
| InChIKey | QPBDQADLSHEWFI-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|