C18H22F3N3O2 — CID 120511636
(2S)-2-[[1-[[4-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]methylamino]hexanoic acid (PubChem CID 120511636) has the molecular formula C18H22F3N3O2 and a molecular weight of 369.39 g/mol. Its IUPAC name is (2S)-2-[[1-[[4-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]methylamino]hexanoic acid.
| Compound Name | (2S)-2-[[1-[[4-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]methylamino]hexanoic acid |
|---|---|
| PubChem CID | 120511636 |
| Molecular Formula | C18H22F3N3O2 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (2S)-2-[[1-[[4-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]methylamino]hexanoic acid |
| SMILES | CCCC[C@H](NCc1cnn(Cc2ccc(C(F)(F)F)cc2)c1)C(=O)O |
| InChI | InChI=1S/C18H22F3N3O2/c1-2-3-4-16(17(25)26)22-9-14-10-23-24(12-14)11-13-5-7-15(8-6-13)18(19,20)21/h5-8,10,12,16,22H,2-4,9,11H2,1H3,(H,25,26)/t16-/m0/s1 |
| InChIKey | SWZPKKBDMSEMJF-INIZCTEOSA-N |
| XLogP | 3.68 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |