C17H21FN2O4 — CID 120513243
2-[[1-(4-fluoro-3-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-3-methylbutanoic acid (PubChem CID 120513243) has the molecular formula C17H21FN2O4 and a molecular weight of 336.36 g/mol. Its IUPAC name is 2-[[1-(4-fluoro-3-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[1-(4-fluoro-3-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 120513243 |
| Molecular Formula | C17H21FN2O4 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 2-[[1-(4-fluoro-3-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-3-methylbutanoic acid |
| SMILES | Cc1cc(N2CC(C(=O)NC(C(=O)O)C(C)C)CC2=O)ccc1F |
| InChI | InChI=1S/C17H21FN2O4/c1-9(2)15(17(23)24)19-16(22)11-7-14(21)20(8-11)12-4-5-13(18)10(3)6-12/h4-6,9,11,15H,7-8H2,1-3H3,(H,19,22)(H,23,24) |
| InChIKey | BSCJUULPBLFKIT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |