C15H22IN3O — CID 120513608
N-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 120513608) has the molecular formula C15H22IN3O and a molecular weight of 387.27 g/mol. Its IUPAC name is N-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 120513608 |
| Molecular Formula | C15H22IN3O |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | N-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | I.c1ccc([C@@H]2OCC[C@H]2CNC2=NCCCN2)cc1 |
| InChI | InChI=1S/C15H21N3O.HI/c1-2-5-12(6-3-1)14-13(7-10-19-14)11-18-15-16-8-4-9-17-15;/h1-3,5-6,13-14H,4,7-11H2,(H2,16,17,18);1H/t13-,14-;/m0./s1 |
| InChIKey | XZBBKMVDMNMIFL-IODNYQNNSA-N |
| XLogP | 2.32 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|