About ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-(ethoxycarbonyloxymethyl)triazole-4-carboxylate
ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-(ethoxycarbonyloxymethyl)triazole-4-carboxylate (PubChem CID 12051530) has the molecular formula C18H20N4O10
and a molecular weight of 452.38 g/mol. Its IUPAC name is ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-(ethoxycarbonyloxymethyl)triazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-(ethoxycarbonyloxymethyl)triazole-4-carboxylate |
| PubChem CID | 12051530 |
| Molecular Formula | C18H20N4O10 |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-(ethoxycarbonyloxymethyl)triazole-4-carboxylate |
| SMILES | CCOC(=O)OCn1nc(C(=O)OCC)c(C(=O)c2cc(OC)c(OC)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C18H20N4O10/c1-5-30-17(24)15-14(19-21(20-15)9-32-18(25)31-6-2)16(23)10-7-12(28-3)13(29-4)8-11(10)22(26)27/h7-8H,5-6,9H2,1-4H3 |
| InChIKey | HYWJFIRMGNLOMZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 171.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-(ethoxycarbonyloxymethyl)triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-(ethoxycarbonyloxymethyl)triazole-4-carboxylate?
The IUPAC name of ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-(ethoxycarbonyloxymethyl)triazole-4-carboxylate (CID 12051530) is ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-(ethoxycarbonyloxymethyl)triazole-4-carboxylate.
What is the SMILES notation for ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-(ethoxycarbonyloxymethyl)triazole-4-carboxylate?
The canonical SMILES for ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-(ethoxycarbonyloxymethyl)triazole-4-carboxylate is CCOC(=O)OCn1nc(C(=O)OCC)c(C(=O)c2cc(OC)c(OC)cc2[N+](=O)[O-])n1.
What is the InChIKey of ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-(ethoxycarbonyloxymethyl)triazole-4-carboxylate?
The InChIKey is HYWJFIRMGNLOMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4O10/c1-5-30-17(24)15-14(19-21(20-15)9-32-18(25)31-6-2)16(23)10-7-12(28-3)13(29-4)8-11(10)22(26)27/h7-8H,5-6,9H2,1-4H3.
What are the key properties of ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-(ethoxycarbonyloxymethyl)triazole-4-carboxylate?
ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-(ethoxycarbonyloxymethyl)triazole-4-carboxylate has a molecular weight of 452.38 g/mol, XLogP of 1.74, 10 rotatable bonds, 0 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(4,5-dimethoxy-2-nitrobenzoyl)-2-(ethoxycarbonyloxymethyl)triazole-4-carboxylate is sourced from PubChem (CID 12051530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).