C17H22N2O5 — CID 120515462
2-[1-(2,4,6-trimethyl-3-nitrobenzoyl)piperidin-4-yl]acetic acid (PubChem CID 120515462) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is 2-[1-(2,4,6-trimethyl-3-nitrobenzoyl)piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-(2,4,6-trimethyl-3-nitrobenzoyl)piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 120515462 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-[1-(2,4,6-trimethyl-3-nitrobenzoyl)piperidin-4-yl]acetic acid |
| SMILES | Cc1cc(C)c([N+](=O)[O-])c(C)c1C(=O)N1CCC(CC(=O)O)CC1 |
| InChI | InChI=1S/C17H22N2O5/c1-10-8-11(2)16(19(23)24)12(3)15(10)17(22)18-6-4-13(5-7-18)9-14(20)21/h8,13H,4-7,9H2,1-3H3,(H,20,21) |
| InChIKey | ICTWCYXDZHMXLN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|