C17H20N2O3S — CID 120517223
2-[2-methylpropyl-(2-methyl-6-thiophen-3-ylpyridine-3-carbonyl)amino]acetic acid (PubChem CID 120517223) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is 2-[2-methylpropyl-(2-methyl-6-thiophen-3-ylpyridine-3-carbonyl)amino]acetic acid.
| Compound Name | 2-[2-methylpropyl-(2-methyl-6-thiophen-3-ylpyridine-3-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 120517223 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-[2-methylpropyl-(2-methyl-6-thiophen-3-ylpyridine-3-carbonyl)amino]acetic acid |
| SMILES | Cc1nc(-c2ccsc2)ccc1C(=O)N(CC(=O)O)CC(C)C |
| InChI | InChI=1S/C17H20N2O3S/c1-11(2)8-19(9-16(20)21)17(22)14-4-5-15(18-12(14)3)13-6-7-23-10-13/h4-7,10-11H,8-9H2,1-3H3,(H,20,21) |
| InChIKey | PRBJVHHDXZUXBS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |