C16H18BrNO4 — CID 120519414
4-[(7-bromo-5-methyl-1-benzofuran-2-carbonyl)amino]-4-methylpentanoic acid (PubChem CID 120519414) has the molecular formula C16H18BrNO4 and a molecular weight of 368.23 g/mol. Its IUPAC name is 4-[(7-bromo-5-methyl-1-benzofuran-2-carbonyl)amino]-4-methylpentanoic acid.
| Compound Name | 4-[(7-bromo-5-methyl-1-benzofuran-2-carbonyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 120519414 |
| Molecular Formula | C16H18BrNO4 |
| Molecular Weight | 368.23 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 4-[(7-bromo-5-methyl-1-benzofuran-2-carbonyl)amino]-4-methylpentanoic acid |
| SMILES | Cc1cc(Br)c2oc(C(=O)NC(C)(C)CCC(=O)O)cc2c1 |
| InChI | InChI=1S/C16H18BrNO4/c1-9-6-10-8-12(22-14(10)11(17)7-9)15(21)18-16(2,3)5-4-13(19)20/h6-8H,4-5H2,1-3H3,(H,18,21)(H,19,20) |
| InChIKey | ZHHWTRXFABEIPN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.23 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |