About triethylsilane
triethylsilane (PubChem CID 12052) has the molecular formula C6H16Si
and a molecular weight of 116.28 g/mol. Its IUPAC name is triethylsilane.
Molecular Properties
| Compound Name | triethylsilane |
| PubChem CID | 12052 |
| Molecular Formula | C6H16Si |
| Molecular Weight | 116.28 g/mol |
| Exact Mass | 116.10 |
| IUPAC Name | triethylsilane |
| SMILES | CC[SiH](CC)CC |
| InChI | InChI=1S/C6H16Si/c1-4-7(5-2)6-3/h7H,4-6H2,1-3H3 |
| InChIKey | AQRLNPVMDITEJU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethylsilane?
The IUPAC name of triethylsilane (CID 12052) is triethylsilane.
What is the SMILES notation for triethylsilane?
The canonical SMILES for triethylsilane is CC[SiH](CC)CC.
What is the InChIKey of triethylsilane?
The InChIKey is AQRLNPVMDITEJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16Si/c1-4-7(5-2)6-3/h7H,4-6H2,1-3H3.
What are the key properties of triethylsilane?
triethylsilane has a molecular weight of 116.28 g/mol, XLogP of 2.27, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triethylsilane is sourced from PubChem (CID 12052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).