About 4-methyl-1,3-oxazolidine-4-carboxylic acid
4-methyl-1,3-oxazolidine-4-carboxylic acid (PubChem CID 12052303) has the molecular formula C5H9NO3
and a molecular weight of 131.13 g/mol. Its IUPAC name is 4-methyl-1,3-oxazolidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 4-methyl-1,3-oxazolidine-4-carboxylic acid |
| PubChem CID | 12052303 |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | 4-methyl-1,3-oxazolidine-4-carboxylic acid |
| SMILES | CC1(C(=O)O)COCN1 |
| InChI | InChI=1S/C5H9NO3/c1-5(4(7)8)2-9-3-6-5/h6H,2-3H2,1H3,(H,7,8) |
| InChIKey | DVCZCGHUUKZMLZ-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-1,3-oxazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,3-oxazolidine-4-carboxylic acid?
The IUPAC name of 4-methyl-1,3-oxazolidine-4-carboxylic acid (CID 12052303) is 4-methyl-1,3-oxazolidine-4-carboxylic acid.
What is the SMILES notation for 4-methyl-1,3-oxazolidine-4-carboxylic acid?
The canonical SMILES for 4-methyl-1,3-oxazolidine-4-carboxylic acid is CC1(C(=O)O)COCN1.
What is the InChIKey of 4-methyl-1,3-oxazolidine-4-carboxylic acid?
The InChIKey is DVCZCGHUUKZMLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3/c1-5(4(7)8)2-9-3-6-5/h6H,2-3H2,1H3,(H,7,8).
What are the key properties of 4-methyl-1,3-oxazolidine-4-carboxylic acid?
4-methyl-1,3-oxazolidine-4-carboxylic acid has a molecular weight of 131.13 g/mol, XLogP of -0.59, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,3-oxazolidine-4-carboxylic acid is sourced from PubChem (CID 12052303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).