4-methyl-1,3-oxazolidine-4-carboxylic acid

C5H9NO3 — CID 12052303

IUPAC4-methyl-1,3-oxazolidine-4-carboxylic acid
SMILESCC1(C(=O)O)COCN1
InChIInChI=1S/C5H9NO3/c1-5(4(7)8)2-9-3-6-5/h6H,2-3H2,1H3,(H,7,8)
InChIKeyDVCZCGHUUKZMLZ-UHFFFAOYSA-N
MW131.13 g/mol
LogP-0.59
Rot. Bonds1

About 4-methyl-1,3-oxazolidine-4-carboxylic acid

4-methyl-1,3-oxazolidine-4-carboxylic acid (PubChem CID 12052303) has the molecular formula C5H9NO3 and a molecular weight of 131.13 g/mol. Its IUPAC name is 4-methyl-1,3-oxazolidine-4-carboxylic acid.

Molecular Properties

Compound Name4-methyl-1,3-oxazolidine-4-carboxylic acid
PubChem CID12052303
Molecular FormulaC5H9NO3
Molecular Weight131.13 g/mol
Exact Mass131.06
IUPAC Name4-methyl-1,3-oxazolidine-4-carboxylic acid
SMILESCC1(C(=O)O)COCN1
InChIInChI=1S/C5H9NO3/c1-5(4(7)8)2-9-3-6-5/h6H,2-3H2,1H3,(H,7,8)
InChIKeyDVCZCGHUUKZMLZ-UHFFFAOYSA-N
XLogP-0.59
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500131.13
LogP ≤ 5-0.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-methyl-1,3-oxazolidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methyl-1,3-oxazolidine-4-carboxylic acid?
The IUPAC name of 4-methyl-1,3-oxazolidine-4-carboxylic acid (CID 12052303) is 4-methyl-1,3-oxazolidine-4-carboxylic acid.
What is the SMILES notation for 4-methyl-1,3-oxazolidine-4-carboxylic acid?
The canonical SMILES for 4-methyl-1,3-oxazolidine-4-carboxylic acid is CC1(C(=O)O)COCN1.
What is the InChIKey of 4-methyl-1,3-oxazolidine-4-carboxylic acid?
The InChIKey is DVCZCGHUUKZMLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3/c1-5(4(7)8)2-9-3-6-5/h6H,2-3H2,1H3,(H,7,8).
What are the key properties of 4-methyl-1,3-oxazolidine-4-carboxylic acid?
4-methyl-1,3-oxazolidine-4-carboxylic acid has a molecular weight of 131.13 g/mol, XLogP of -0.59, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,3-oxazolidine-4-carboxylic acid is sourced from PubChem (CID 12052303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).