C14H17NO4S — CID 120523516
2-[3-(thiane-4-carbonylamino)phenoxy]acetic acid (PubChem CID 120523516) has the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-[3-(thiane-4-carbonylamino)phenoxy]acetic acid.
| Compound Name | 2-[3-(thiane-4-carbonylamino)phenoxy]acetic acid |
|---|---|
| PubChem CID | 120523516 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-[3-(thiane-4-carbonylamino)phenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(NC(=O)C2CCSCC2)c1 |
| InChI | InChI=1S/C14H17NO4S/c16-13(17)9-19-12-3-1-2-11(8-12)15-14(18)10-4-6-20-7-5-10/h1-3,8,10H,4-7,9H2,(H,15,18)(H,16,17) |
| InChIKey | INLFOHPQHGAFKO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |