About methyl 2-amino-3-oxobutanoate
methyl 2-amino-3-oxobutanoate (PubChem CID 12052398) has the molecular formula C5H9NO3
and a molecular weight of 131.13 g/mol. Its IUPAC name is methyl 2-amino-3-oxobutanoate.
Molecular Properties
| Compound Name | methyl 2-amino-3-oxobutanoate |
| PubChem CID | 12052398 |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | methyl 2-amino-3-oxobutanoate |
| SMILES | COC(=O)C(N)C(C)=O |
| InChI | InChI=1S/C5H9NO3/c1-3(7)4(6)5(8)9-2/h4H,6H2,1-2H3 |
| InChIKey | JJJKPDCCZFMOJD-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-amino-3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-3-oxobutanoate?
The IUPAC name of methyl 2-amino-3-oxobutanoate (CID 12052398) is methyl 2-amino-3-oxobutanoate.
What is the SMILES notation for methyl 2-amino-3-oxobutanoate?
The canonical SMILES for methyl 2-amino-3-oxobutanoate is COC(=O)C(N)C(C)=O.
What is the InChIKey of methyl 2-amino-3-oxobutanoate?
The InChIKey is JJJKPDCCZFMOJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3/c1-3(7)4(6)5(8)9-2/h4H,6H2,1-2H3.
What are the key properties of methyl 2-amino-3-oxobutanoate?
methyl 2-amino-3-oxobutanoate has a molecular weight of 131.13 g/mol, XLogP of -0.92, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-3-oxobutanoate is sourced from PubChem (CID 12052398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).